C27H25NO2P2 — CID 10813717
(E)-N,1-bis(diphenylphosphoryl)propan-2-imine (PubChem CID 10813717) has the molecular formula C27H25NO2P2 and a molecular weight of 457.45 g/mol. Its IUPAC name is (E)-N,1-bis(diphenylphosphoryl)propan-2-imine.
| Compound Name | (E)-N,1-bis(diphenylphosphoryl)propan-2-imine |
|---|---|
| PubChem CID | 10813717 |
| Molecular Formula | C27H25NO2P2 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (E)-N,1-bis(diphenylphosphoryl)propan-2-imine |
| SMILES | C/C(CP(=O)(c1ccccc1)c1ccccc1)=N\P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO2P2/c1-23(22-31(29,24-14-6-2-7-15-24)25-16-8-3-9-17-25)28-32(30,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21H,22H2,1H3/b28-23+ |
| InChIKey | JUTNPXGUKJLQIZ-WEMUOSSPSA-N |
| XLogP | 5.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|