C23H22NOP — CID 10666173
(E,E)-N-diphenylphosphoryl-4-(4-methylphenyl)but-3-en-2-imine (PubChem CID 10666173) has the molecular formula C23H22NOP and a molecular weight of 359.41 g/mol. Its IUPAC name is (E,E)-N-diphenylphosphoryl-4-(4-methylphenyl)but-3-en-2-imine.
| Compound Name | (E,E)-N-diphenylphosphoryl-4-(4-methylphenyl)but-3-en-2-imine |
|---|---|
| PubChem CID | 10666173 |
| Molecular Formula | C23H22NOP |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (E,E)-N-diphenylphosphoryl-4-(4-methylphenyl)but-3-en-2-imine |
| SMILES | CC(/C=C/c1ccc(C)cc1)=N\P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22NOP/c1-19-13-16-21(17-14-19)18-15-20(2)24-26(25,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-18H,1-2H3/b18-15+,24-20+ |
| InChIKey | IHHIQJKDFRBTNZ-HKRBAAFQSA-N |
| XLogP | 5.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|