C30H27OP — CID 11532149
1-[(1E,3E)-4-diphenylphosphoryl-4-(4-methylphenyl)buta-1,3-dienyl]-4-methylbenzene (PubChem CID 11532149) has the molecular formula C30H27OP and a molecular weight of 434.52 g/mol. Its IUPAC name is 1-[(1E,3E)-4-diphenylphosphoryl-4-(4-methylphenyl)buta-1,3-dienyl]-4-methylbenzene.
| Compound Name | 1-[(1E,3E)-4-diphenylphosphoryl-4-(4-methylphenyl)buta-1,3-dienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 11532149 |
| Molecular Formula | C30H27OP |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[(1E,3E)-4-diphenylphosphoryl-4-(4-methylphenyl)buta-1,3-dienyl]-4-methylbenzene |
| SMILES | Cc1ccc(/C=C/C=C(\c2ccc(C)cc2)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27OP/c1-24-16-20-26(21-17-24)10-9-15-30(27-22-18-25(2)19-23-27)32(31,28-11-5-3-6-12-28)29-13-7-4-8-14-29/h3-23H,1-2H3/b10-9+,30-15+ |
| InChIKey | QTNGQAGJZXELGE-IMDKXTBQSA-N |
| XLogP | 7.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|