C22H18Cl2NO2P — CID 3090259
N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-methylbenzamide (PubChem CID 3090259) has the molecular formula C22H18Cl2NO2P and a molecular weight of 430.27 g/mol. Its IUPAC name is N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-methylbenzamide.
| Compound Name | N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 3090259 |
| Molecular Formula | C22H18Cl2NO2P |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=C(Cl)Cl)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18Cl2NO2P/c1-16-12-14-17(15-13-16)21(26)25-22(20(23)24)28(27,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15H,1H3,(H,25,26) |
| InChIKey | WLOXPJPADJDQGM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|