C28H23ClNO2PS — CID 3438754
N-[2-chloro-1-diphenylphosphoryl-2-(4-methylphenyl)sulfanylethenyl]benzamide (PubChem CID 3438754) has the molecular formula C28H23ClNO2PS and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[2-chloro-1-diphenylphosphoryl-2-(4-methylphenyl)sulfanylethenyl]benzamide.
| Compound Name | N-[2-chloro-1-diphenylphosphoryl-2-(4-methylphenyl)sulfanylethenyl]benzamide |
|---|---|
| PubChem CID | 3438754 |
| Molecular Formula | C28H23ClNO2PS |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[2-chloro-1-diphenylphosphoryl-2-(4-methylphenyl)sulfanylethenyl]benzamide |
| SMILES | Cc1ccc(SC(Cl)=C(NC(=O)c2ccccc2)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23ClNO2PS/c1-21-17-19-25(20-18-21)34-26(29)28(30-27(31)22-11-5-2-6-12-22)33(32,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20H,1H3,(H,30,31) |
| InChIKey | WQZDWHMDHWNHRA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|