C23H17Cl2NO3S2 — CID 15562206
methyl 2-benzamido-3,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate (PubChem CID 15562206) has the molecular formula C23H17Cl2NO3S2 and a molecular weight of 490.43 g/mol. Its IUPAC name is methyl 2-benzamido-3,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate.
| Compound Name | methyl 2-benzamido-3,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 15562206 |
| Molecular Formula | C23H17Cl2NO3S2 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | methyl 2-benzamido-3,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1)=C(Sc1ccc(Cl)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2NO3S2/c1-29-22(28)20(26-21(27)15-5-3-2-4-6-15)23(30-18-11-7-16(24)8-12-18)31-19-13-9-17(25)10-14-19/h2-14H,1H3,(H,26,27) |
| InChIKey | LUTINOOUCKWLPI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|