C26H22Cl2N2OS2 — CID 73254159
N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]-4-tert-butylbenzamide (PubChem CID 73254159) has the molecular formula C26H22Cl2N2OS2 and a molecular weight of 513.52 g/mol. Its IUPAC name is N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]-4-tert-butylbenzamide.
| Compound Name | N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 73254159 |
| Molecular Formula | C26H22Cl2N2OS2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(C#N)=C(Sc2ccc(Cl)cc2)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H22Cl2N2OS2/c1-26(2,3)18-6-4-17(5-7-18)24(31)30-23(16-29)25(32-21-12-8-19(27)9-13-21)33-22-14-10-20(28)11-15-22/h4-15H,1-3H3,(H,30,31) |
| InChIKey | FZVSMEKUXXWFBV-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|