C22H14Br2N2OS2 — CID 45148603
N-[2,2-bis[(4-bromophenyl)sulfanyl]-1-cyanoethenyl]benzamide (PubChem CID 45148603) has the molecular formula C22H14Br2N2OS2 and a molecular weight of 546.31 g/mol. Its IUPAC name is N-[2,2-bis[(4-bromophenyl)sulfanyl]-1-cyanoethenyl]benzamide.
| Compound Name | N-[2,2-bis[(4-bromophenyl)sulfanyl]-1-cyanoethenyl]benzamide |
|---|---|
| PubChem CID | 45148603 |
| Molecular Formula | C22H14Br2N2OS2 |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 543.89 |
| IUPAC Name | N-[2,2-bis[(4-bromophenyl)sulfanyl]-1-cyanoethenyl]benzamide |
| SMILES | N#CC(NC(=O)c1ccccc1)=C(Sc1ccc(Br)cc1)Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H14Br2N2OS2/c23-16-6-10-18(11-7-16)28-22(29-19-12-8-17(24)9-13-19)20(14-25)26-21(27)15-4-2-1-3-5-15/h1-13H,(H,26,27) |
| InChIKey | LUSNYRREHBTORF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|