C12H7N5O — CID 569500
N'-(1,2,2-tricyanoethenyl)benzohydrazide (PubChem CID 569500) has the molecular formula C12H7N5O and a molecular weight of 237.22 g/mol. Its IUPAC name is N'-(1,2,2-tricyanoethenyl)benzohydrazide.
| Compound Name | N'-(1,2,2-tricyanoethenyl)benzohydrazide |
|---|---|
| PubChem CID | 569500 |
| Molecular Formula | C12H7N5O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N'-(1,2,2-tricyanoethenyl)benzohydrazide |
| SMILES | N#CC(C#N)=C(C#N)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H7N5O/c13-6-10(7-14)11(8-15)16-17-12(18)9-4-2-1-3-5-9/h1-5,16H,(H,17,18) |
| InChIKey | HGKKHBLARUPHCH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|