C20H15N5O — CID 168607076
N-(1-phenylethyl)-4-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168607076) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(1-phenylethyl)-4-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-(1-phenylethyl)-4-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168607076 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(1-phenylethyl)-4-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC(C#N)=C(C#N)C#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H15N5O/c1-14(15-5-3-2-4-6-15)24-20(26)16-7-9-18(10-8-16)25-19(13-23)17(11-21)12-22/h2-10,14,25H,1H3,(H,24,26) |
| InChIKey | HTJIHRPZRVEEHV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|