C22H20N2O3 — CID 42578583
2-hydroxy-N-[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]benzamide (PubChem CID 42578583) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-hydroxy-N-[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2-hydroxy-N-[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 42578583 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-hydroxy-N-[4-[[(1S)-1-phenylethyl]carbamoyl]phenyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(NC(=O)c2ccccc2O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3/c1-15(16-7-3-2-4-8-16)23-21(26)17-11-13-18(14-12-17)24-22(27)19-9-5-6-10-20(19)25/h2-15,25H,1H3,(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | VZYBDFXCRNASIG-HNNXBMFYSA-N |
| XLogP | 4.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |