C22H18ClN3O3S — CID 2801441
methyl (E)-2-benzamido-3-[[6-(4-chlorophenyl)sulfanyl-3-pyridinyl]amino]prop-2-enoate (PubChem CID 2801441) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is methyl (E)-2-benzamido-3-[[6-(4-chlorophenyl)sulfanyl-3-pyridinyl]amino]prop-2-enoate.
| Compound Name | methyl (E)-2-benzamido-3-[[6-(4-chlorophenyl)sulfanyl-3-pyridinyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 2801441 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | methyl (E)-2-benzamido-3-[[6-(4-chlorophenyl)sulfanyl-3-pyridinyl]amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C\Nc1ccc(Sc2ccc(Cl)cc2)nc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3O3S/c1-29-22(28)19(26-21(27)15-5-3-2-4-6-15)14-24-17-9-12-20(25-13-17)30-18-10-7-16(23)8-11-18/h2-14,24H,1H3,(H,26,27)/b19-14+ |
| InChIKey | NXPGDYHHZIZXCS-XMHGGMMESA-N |
| XLogP | 4.74 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|