C36H37F2N5O6 — CID 158850152
4-fluoroaniline;methyl (E)-2-benzamido-3-(dimethylamino)prop-2-enoate;methyl (E)-2-benzamido-3-(4-fluoroanilino)prop-2-enoate (PubChem CID 158850152) has the molecular formula C36H37F2N5O6 and a molecular weight of 673.72 g/mol. Its IUPAC name is 4-fluoroaniline;methyl (E)-2-benzamido-3-(dimethylamino)prop-2-enoate;methyl (E)-2-benzamido-3-(4-fluoroanilino)prop-2-enoate.
| Compound Name | 4-fluoroaniline;methyl (E)-2-benzamido-3-(dimethylamino)prop-2-enoate;methyl (E)-2-benzamido-3-(4-fluoroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 158850152 |
| Molecular Formula | C36H37F2N5O6 |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | 4-fluoroaniline;methyl (E)-2-benzamido-3-(dimethylamino)prop-2-enoate;methyl (E)-2-benzamido-3-(4-fluoroanilino)prop-2-enoate |
| SMILES | COC(=O)/C(=C\N(C)C)NC(=O)c1ccccc1.COC(=O)/C(=C\Nc1ccc(F)cc1)NC(=O)c1ccccc1.Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O3.C13H16N2O3.C6H6FN/c1-23-17(22)15(11-19-14-9-7-13(18)8-10-14)20-16(21)12-5-3-2-4-6-12;1-15(2)9-11(13(17)18-3)14-12(16)10-7-5-4-6-8-10;7-5-1-3-6(8)4-2-5/h2-11,19H,1H3,(H,20,21);4-9H,1-3H3,(H,14,16);1-4H,8H2/b15-11+;11-9+; |
| InChIKey | IZIPBVODZMGBEO-OMGPPSQBSA-N |
| XLogP | 5.08 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|