C18H19FN2O3 — CID 147672290
methyl (E)-2-benzamido-3-[(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]prop-2-enoate (PubChem CID 147672290) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is methyl (E)-2-benzamido-3-[(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]prop-2-enoate.
| Compound Name | methyl (E)-2-benzamido-3-[(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 147672290 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | methyl (E)-2-benzamido-3-[(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C\NC1=CC=C(F)CC1C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-12-10-14(19)8-9-15(12)20-11-16(18(23)24-2)21-17(22)13-6-4-3-5-7-13/h3-9,11-12,20H,10H2,1-2H3,(H,21,22)/b16-11+ |
| InChIKey | GNLZWEZEEQNEDB-LFIBNONCSA-N |
| XLogP | 2.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|