C16H16ClNO3 — CID 77292704
methyl 2-benzamido-3-(2-chlorocyclopenten-1-yl)prop-2-enoate (PubChem CID 77292704) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is methyl 2-benzamido-3-(2-chlorocyclopenten-1-yl)prop-2-enoate.
| Compound Name | methyl 2-benzamido-3-(2-chlorocyclopenten-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 77292704 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | methyl 2-benzamido-3-(2-chlorocyclopenten-1-yl)prop-2-enoate |
| SMILES | COC(=O)C(=CC1=C(Cl)CCC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO3/c1-21-16(20)14(10-12-8-5-9-13(12)17)18-15(19)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3,(H,18,19) |
| InChIKey | HKENFTFBSWPTKA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|