C21H16ClNO3S — CID 58631845
methyl (Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoate (PubChem CID 58631845) has the molecular formula C21H16ClNO3S and a molecular weight of 397.88 g/mol. Its IUPAC name is methyl (Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoate.
| Compound Name | methyl (Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58631845 |
| Molecular Formula | C21H16ClNO3S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | methyl (Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(-c2ccccc2Cl)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16ClNO3S/c1-26-21(25)18(23-20(24)14-7-3-2-4-8-14)13-15-11-12-19(27-15)16-9-5-6-10-17(16)22/h2-13H,1H3,(H,23,24)/b18-13- |
| InChIKey | ORFWZCJWMZPNMB-AQTBWJFISA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|