C23H19ClN2O4S — CID 22148097
methyl 2-[[(E)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]acetate (PubChem CID 22148097) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is methyl 2-[[(E)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]acetate.
| Compound Name | methyl 2-[[(E)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 22148097 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | methyl 2-[[(E)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)/C(=C\c1ccc(-c2ccccc2Cl)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN2O4S/c1-30-21(27)14-25-23(29)19(26-22(28)15-7-3-2-4-8-15)13-16-11-12-20(31-16)17-9-5-6-10-18(17)24/h2-13H,14H2,1H3,(H,25,29)(H,26,28)/b19-13+ |
| InChIKey | FBVGWYCTRRLGJZ-CPNJWEJPSA-N |
| XLogP | 4.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|