C23H17ClN2O5S — CID 163598468
chloro 5-[(Z)-2-benzamido-3-oxo-3-(phenacylamino)prop-1-enyl]thiophene-2-carboxylate (PubChem CID 163598468) has the molecular formula C23H17ClN2O5S and a molecular weight of 468.92 g/mol. Its IUPAC name is chloro 5-[(Z)-2-benzamido-3-oxo-3-(phenacylamino)prop-1-enyl]thiophene-2-carboxylate.
| Compound Name | chloro 5-[(Z)-2-benzamido-3-oxo-3-(phenacylamino)prop-1-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 163598468 |
| Molecular Formula | C23H17ClN2O5S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | chloro 5-[(Z)-2-benzamido-3-oxo-3-(phenacylamino)prop-1-enyl]thiophene-2-carboxylate |
| SMILES | O=C(NCC(=O)c1ccccc1)/C(=C/c1ccc(C(=O)OCl)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17ClN2O5S/c24-31-23(30)20-12-11-17(32-20)13-18(26-21(28)16-9-5-2-6-10-16)22(29)25-14-19(27)15-7-3-1-4-8-15/h1-13H,14H2,(H,25,29)(H,26,28)/b18-13- |
| InChIKey | GVNIDOUAJSNGEV-AQTBWJFISA-N |
| XLogP | 3.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|