C21H21ClN2O4S — CID 74063748
methyl 3-[[2-benzamido-3-[5-(3-chloroprop-1-en-2-yl)thiophen-2-yl]prop-2-enoyl]amino]propanoate (PubChem CID 74063748) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is methyl 3-[[2-benzamido-3-[5-(3-chloroprop-1-en-2-yl)thiophen-2-yl]prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-[[2-benzamido-3-[5-(3-chloroprop-1-en-2-yl)thiophen-2-yl]prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 74063748 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | methyl 3-[[2-benzamido-3-[5-(3-chloroprop-1-en-2-yl)thiophen-2-yl]prop-2-enoyl]amino]propanoate |
| SMILES | C=C(CCl)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NCCC(=O)OC)s1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-14(13-22)18-9-8-16(29-18)12-17(21(27)23-11-10-19(25)28-2)24-20(26)15-6-4-3-5-7-15/h3-9,12H,1,10-11,13H2,2H3,(H,23,27)(H,24,26) |
| InChIKey | NSHKWIOAQRWFRD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|