C23H19ClN2O4S — CID 58586060
3-[[(Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]propanoic acid (PubChem CID 58586060) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is 3-[[(Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58586060 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 3-[[(Z)-2-benzamido-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)/C(=C/c1ccc(-c2ccccc2Cl)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN2O4S/c24-18-9-5-4-8-17(18)20-11-10-16(31-20)14-19(23(30)25-13-12-21(27)28)26-22(29)15-6-2-1-3-7-15/h1-11,14H,12-13H2,(H,25,30)(H,26,29)(H,27,28)/b19-14- |
| InChIKey | WURFDDLFSXSBHT-RGEXLXHISA-N |
| XLogP | 4.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|