C19H17N3O6 — CID 3095002
3-[[2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 3095002) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is 3-[[2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 3095002 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-[[2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(=Cc1ccccc1[N+](=O)[O-])NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O6/c23-17(24)10-11-20-19(26)15(21-18(25)13-6-2-1-3-7-13)12-14-8-4-5-9-16(14)22(27)28/h1-9,12H,10-11H2,(H,20,26)(H,21,25)(H,23,24) |
| InChIKey | QKTJRCNPINASRO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|