C20H13Cl2NO3S — CID 22148254
(E)-2-[(2-chlorobenzoyl)amino]-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 22148254) has the molecular formula C20H13Cl2NO3S and a molecular weight of 418.30 g/mol. Its IUPAC name is (E)-2-[(2-chlorobenzoyl)amino]-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-[(2-chlorobenzoyl)amino]-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148254 |
| Molecular Formula | C20H13Cl2NO3S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | (E)-2-[(2-chlorobenzoyl)amino]-3-[5-(2-chlorophenyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(-c2ccccc2Cl)s1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H13Cl2NO3S/c21-15-7-3-1-5-13(15)18-10-9-12(27-18)11-17(20(25)26)23-19(24)14-6-2-4-8-16(14)22/h1-11H,(H,23,24)(H,25,26)/b17-11+ |
| InChIKey | YMFJXWXWNAXVAD-GZTJUZNOSA-N |
| XLogP | 5.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|