C18H11ClN2O6S — CID 58631939
(Z)-3-[5-(2-chlorophenyl)thiophen-2-yl]-2-[(5-nitrofuran-2-carbonyl)amino]prop-2-enoic acid (PubChem CID 58631939) has the molecular formula C18H11ClN2O6S and a molecular weight of 418.81 g/mol. Its IUPAC name is (Z)-3-[5-(2-chlorophenyl)thiophen-2-yl]-2-[(5-nitrofuran-2-carbonyl)amino]prop-2-enoic acid.
| Compound Name | (Z)-3-[5-(2-chlorophenyl)thiophen-2-yl]-2-[(5-nitrofuran-2-carbonyl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 58631939 |
| Molecular Formula | C18H11ClN2O6S |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | (Z)-3-[5-(2-chlorophenyl)thiophen-2-yl]-2-[(5-nitrofuran-2-carbonyl)amino]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccc(-c2ccccc2Cl)s1)NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H11ClN2O6S/c19-12-4-2-1-3-11(12)15-7-5-10(28-15)9-13(18(23)24)20-17(22)14-6-8-16(27-14)21(25)26/h1-9H,(H,20,22)(H,23,24)/b13-9- |
| InChIKey | DAGFDUJQHQEOCM-LCYFTJDESA-N |
| XLogP | 4.43 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|