C18H12N2O7 — CID 22148599
(E)-2-[(5-nitrofuran-2-carbonyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid (PubChem CID 22148599) has the molecular formula C18H12N2O7 and a molecular weight of 368.30 g/mol. Its IUPAC name is (E)-2-[(5-nitrofuran-2-carbonyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-[(5-nitrofuran-2-carbonyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148599 |
| Molecular Formula | C18H12N2O7 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (E)-2-[(5-nitrofuran-2-carbonyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(-c2ccccc2)o1)NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H12N2O7/c21-17(15-8-9-16(27-15)20(24)25)19-13(18(22)23)10-12-6-7-14(26-12)11-4-2-1-3-5-11/h1-10H,(H,19,21)(H,22,23)/b13-10+ |
| InChIKey | XALOHWAGXDYFJZ-JLHYYAGUSA-N |
| XLogP | 3.30 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|