C8H8N4O6 — CID 20981860
2-(2-carbamoylhydrazinyl)-3-(5-nitrofuran-2-yl)prop-2-enoic acid (PubChem CID 20981860) has the molecular formula C8H8N4O6 and a molecular weight of 256.17 g/mol. Its IUPAC name is 2-(2-carbamoylhydrazinyl)-3-(5-nitrofuran-2-yl)prop-2-enoic acid.
| Compound Name | 2-(2-carbamoylhydrazinyl)-3-(5-nitrofuran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 20981860 |
| Molecular Formula | C8H8N4O6 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(2-carbamoylhydrazinyl)-3-(5-nitrofuran-2-yl)prop-2-enoic acid |
| SMILES | NC(=O)NNC(=Cc1ccc([N+](=O)[O-])o1)C(=O)O |
| InChI | InChI=1S/C8H8N4O6/c9-8(15)11-10-5(7(13)14)3-4-1-2-6(18-4)12(16)17/h1-3,10H,(H,13,14)(H3,9,11,15) |
| InChIKey | KJIRJNXXUUMBNC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|