C9H8N4O5 — CID 23424395
N'-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]oxamide (PubChem CID 23424395) has the molecular formula C9H8N4O5 and a molecular weight of 252.19 g/mol. Its IUPAC name is N'-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]oxamide.
| Compound Name | N'-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]oxamide |
|---|---|
| PubChem CID | 23424395 |
| Molecular Formula | C9H8N4O5 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N'-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]oxamide |
| SMILES | NC(=O)C(=O)N/N=C/C=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H8N4O5/c10-8(14)9(15)12-11-5-1-2-6-3-4-7(18-6)13(16)17/h1-5H,(H2,10,14)(H,12,15)/b2-1+,11-5+ |
| InChIKey | CKKJOMUCSUPIDH-UAIOPKHMSA-N |
| XLogP | -0.21 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|