C20H22N8O6PdS2 — CID 11982845
bis(N'-ethyl-N-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]carbamimidothioate);palladium(2+) (PubChem CID 11982845) has the molecular formula C20H22N8O6PdS2 and a molecular weight of 641.00 g/mol. Its IUPAC name is bis(N'-ethyl-N-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]carbamimidothioate);palladium(2+).
| Compound Name | bis(N'-ethyl-N-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]carbamimidothioate);palladium(2+) |
|---|---|
| PubChem CID | 11982845 |
| Molecular Formula | C20H22N8O6PdS2 |
| Molecular Weight | 641.00 g/mol |
| Exact Mass | 640.01 |
| IUPAC Name | bis(N'-ethyl-N-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]carbamimidothioate);palladium(2+) |
| SMILES | CC/N=C(/[S-])N/N=C/C=C/c1ccc([N+](=O)[O-])o1.CC/N=C(\[S-])N/N=C/C=C/c1ccc([N+](=O)[O-])o1.[Pd+2] |
| InChI | InChI=1S/2C10H12N4O3S.Pd/c2*1-2-11-10(18)13-12-7-3-4-8-5-6-9(17-8)14(15)16;/h2*3-7H,2H2,1H3,(H2,11,13,18);/q;;+2/p-2/b2*4-3+,12-7+; |
| InChIKey | ICORSEFGSPNNEE-RSOGRDPQSA-L |
| XLogP | 3.40 |
| TPSA | 186.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.00 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|