C17H12N4O6 — CID 71086640
4-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 71086640) has the molecular formula C17H12N4O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is 4-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 71086640 |
| Molecular Formula | C17H12N4O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 4-hydroxy-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(N/N=C\C=C\c1ccc([N+](=O)[O-])o1)c1[nH]c(=O)c2ccccc2c1O |
| InChI | InChI=1S/C17H12N4O6/c22-15-11-5-1-2-6-12(11)16(23)19-14(15)17(24)20-18-9-3-4-10-7-8-13(27-10)21(25)26/h1-9,22H,(H,19,23)(H,20,24)/b4-3+,18-9- |
| InChIKey | LJOMAZIYRNQBCM-DXGRHRPDSA-N |
| XLogP | 2.16 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|