C20H15NO6 — CID 22148076
(E)-2-[(3,5-dihydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid (PubChem CID 22148076) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is (E)-2-[(3,5-dihydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-[(3,5-dihydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148076 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (E)-2-[(3,5-dihydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(-c2ccccc2)o1)NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C20H15NO6/c22-14-8-13(9-15(23)10-14)19(24)21-17(20(25)26)11-16-6-7-18(27-16)12-4-2-1-3-5-12/h1-11,22-23H,(H,21,24)(H,25,26)/b17-11+ |
| InChIKey | VYIBTNDYLIRQKO-GZTJUZNOSA-N |
| XLogP | 3.21 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|