C20H15ClN2O4 — CID 76823927
2-[(3-aminobenzoyl)amino]-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 76823927) has the molecular formula C20H15ClN2O4 and a molecular weight of 382.80 g/mol. Its IUPAC name is 2-[(3-aminobenzoyl)amino]-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | 2-[(3-aminobenzoyl)amino]-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76823927 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-[(3-aminobenzoyl)amino]-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoic acid |
| SMILES | Nc1cccc(C(=O)NC(=Cc2ccc(-c3ccccc3Cl)o2)C(=O)O)c1 |
| InChI | InChI=1S/C20H15ClN2O4/c21-16-7-2-1-6-15(16)18-9-8-14(27-18)11-17(20(25)26)23-19(24)12-4-3-5-13(22)10-12/h1-11H,22H2,(H,23,24)(H,25,26) |
| InChIKey | UGNWAQLXWYNNIG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|