C18H11Cl2NO5 — CID 4889065
3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-(furan-2-carbonylamino)prop-2-enoic acid (PubChem CID 4889065) has the molecular formula C18H11Cl2NO5 and a molecular weight of 392.19 g/mol. Its IUPAC name is 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-(furan-2-carbonylamino)prop-2-enoic acid.
| Compound Name | 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-(furan-2-carbonylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 4889065 |
| Molecular Formula | C18H11Cl2NO5 |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 3-[5-(2,6-dichlorophenyl)furan-2-yl]-2-(furan-2-carbonylamino)prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1ccc(-c2c(Cl)cccc2Cl)o1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H11Cl2NO5/c19-11-3-1-4-12(20)16(11)14-7-6-10(26-14)9-13(18(23)24)21-17(22)15-5-2-8-25-15/h1-9H,(H,21,22)(H,23,24) |
| InChIKey | BLWNPQYQIIGAIH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|