C20H15NO5 — CID 22148255
(E)-2-[(2-hydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid (PubChem CID 22148255) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is (E)-2-[(2-hydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid.
| Compound Name | (E)-2-[(2-hydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22148255 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (E)-2-[(2-hydroxybenzoyl)amino]-3-(5-phenylfuran-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(-c2ccccc2)o1)NC(=O)c1ccccc1O |
| InChI | InChI=1S/C20H15NO5/c22-17-9-5-4-8-15(17)19(23)21-16(20(24)25)12-14-10-11-18(26-14)13-6-2-1-3-7-13/h1-12,22H,(H,21,23)(H,24,25)/b16-12+ |
| InChIKey | ZSRNLKSKUGDDIJ-FOWTUZBSSA-N |
| XLogP | 3.51 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|