C23H21NO4 — CID 74063736
2-benzamido-3-[5-(4-propylphenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 74063736) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-benzamido-3-[5-(4-propylphenyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | 2-benzamido-3-[5-(4-propylphenyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 74063736 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-benzamido-3-[5-(4-propylphenyl)furan-2-yl]prop-2-enoic acid |
| SMILES | CCCc1ccc(-c2ccc(C=C(NC(=O)c3ccccc3)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C23H21NO4/c1-2-6-16-9-11-17(12-10-16)21-14-13-19(28-21)15-20(23(26)27)24-22(25)18-7-4-3-5-8-18/h3-5,7-15H,2,6H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | VPINMBDIDQGGOO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|