C14H8Cl2NO4- — CID 2203117
(E)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoate (PubChem CID 2203117) has the molecular formula C14H8Cl2NO4- and a molecular weight of 325.13 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoate.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 2203117 |
| Molecular Formula | C14H8Cl2NO4- |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoate |
| SMILES | O=C([O-])/C(=C\c1ccc(Cl)cc1Cl)NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H9Cl2NO4/c15-9-4-3-8(10(16)7-9)6-11(14(19)20)17-13(18)12-2-1-5-21-12/h1-7H,(H,17,18)(H,19,20)/p-1/b11-6+ |
| InChIKey | JDSQJPLENDCDFK-IZZDOVSWSA-M |
| XLogP | 2.11 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|