C21H14ClN2O5- — CID 7454963
3-[[(E)-3-(2-chlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoate (PubChem CID 7454963) has the molecular formula C21H14ClN2O5- and a molecular weight of 409.81 g/mol. Its IUPAC name is 3-[[(E)-3-(2-chlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoate.
| Compound Name | 3-[[(E)-3-(2-chlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 7454963 |
| Molecular Formula | C21H14ClN2O5- |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 3-[[(E)-3-(2-chlorophenyl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]benzoate |
| SMILES | O=C(Nc1cccc(C(=O)[O-])c1)/C(=C\c1ccccc1Cl)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H15ClN2O5/c22-16-8-2-1-5-13(16)12-17(24-20(26)18-9-4-10-29-18)19(25)23-15-7-3-6-14(11-15)21(27)28/h1-12H,(H,23,25)(H,24,26)(H,27,28)/p-1/b17-12+ |
| InChIKey | JODPLYLPLZKLQX-SFQUDFHCSA-M |
| XLogP | 2.71 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|