C22H18N2O5 — CID 1371882
methyl 3-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]benzoate (PubChem CID 1371882) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is methyl 3-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 1371882 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl 3-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C22H18N2O5/c1-28-22(27)16-9-5-10-17(14-16)23-20(25)18(13-15-7-3-2-4-8-15)24-21(26)19-11-6-12-29-19/h2-14H,1H3,(H,23,25)(H,24,26) |
| InChIKey | COVFJFHUOFOEOH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|