C19H11Cl2N3O2 — CID 5477968
N-[(1Z)-4,4-dicyano-1-(2,4-dichlorophenyl)-3-hydroxybuta-1,3-dien-2-yl]benzamide (PubChem CID 5477968) has the molecular formula C19H11Cl2N3O2 and a molecular weight of 384.22 g/mol. Its IUPAC name is N-[(1Z)-4,4-dicyano-1-(2,4-dichlorophenyl)-3-hydroxybuta-1,3-dien-2-yl]benzamide.
| Compound Name | N-[(1Z)-4,4-dicyano-1-(2,4-dichlorophenyl)-3-hydroxybuta-1,3-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 5477968 |
| Molecular Formula | C19H11Cl2N3O2 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[(1Z)-4,4-dicyano-1-(2,4-dichlorophenyl)-3-hydroxybuta-1,3-dien-2-yl]benzamide |
| SMILES | N#CC(C#N)=C(O)/C(=C/c1ccc(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H11Cl2N3O2/c20-15-7-6-13(16(21)9-15)8-17(18(25)14(10-22)11-23)24-19(26)12-4-2-1-3-5-12/h1-9,25H,(H,24,26)/b17-8- |
| InChIKey | KETVZXVGPMSBDX-IUXPMGMMSA-N |
| XLogP | 4.62 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|