C24H17Cl2N3O2 — CID 19058549
N-[(E)-1-(2,4-dichlorophenyl)-3-(1H-indol-6-ylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19058549) has the molecular formula C24H17Cl2N3O2 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)-3-(1H-indol-6-ylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)-3-(1H-indol-6-ylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19058549 |
| Molecular Formula | C24H17Cl2N3O2 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)-3-(1H-indol-6-ylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2cc[nH]c2c1)/C(=C\c1ccc(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2N3O2/c25-18-8-6-17(20(26)13-18)12-22(29-23(30)16-4-2-1-3-5-16)24(31)28-19-9-7-15-10-11-27-21(15)14-19/h1-14,27H,(H,28,31)(H,29,30)/b22-12+ |
| InChIKey | NIHGPVJRGBIONX-WSDLNYQXSA-N |
| XLogP | 5.88 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|