C34H28Cl2N4O3S — CID 19319359
N-[(E)-1-(2,3-dichlorophenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319359) has the molecular formula C34H28Cl2N4O3S and a molecular weight of 643.60 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dichlorophenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,3-dichlorophenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319359 |
| Molecular Formula | C34H28Cl2N4O3S |
| Molecular Weight | 643.60 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | N-[(E)-1-(2,3-dichlorophenyl)-3-[3-[1-(1H-indol-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C34H28Cl2N4O3S/c1-2-30(34(43)39-25-15-14-21-16-17-37-28(21)20-25)44-26-12-7-11-24(19-26)38-33(42)29(18-23-10-6-13-27(35)31(23)36)40-32(41)22-8-4-3-5-9-22/h3-20,30,37H,2H2,1H3,(H,38,42)(H,39,43)(H,40,41)/b29-18+ |
| InChIKey | TYPVCXKQIFCWCH-RDRPBHBLSA-N |
| XLogP | 8.39 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.60 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|