C33H27Cl2N3O6S — CID 19306670
5-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid (PubChem CID 19306670) has the molecular formula C33H27Cl2N3O6S and a molecular weight of 664.57 g/mol. Its IUPAC name is 5-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19306670 |
| Molecular Formula | C33H27Cl2N3O6S |
| Molecular Weight | 664.57 g/mol |
| Exact Mass | 663.10 |
| IUPAC Name | 5-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C33H27Cl2N3O6S/c1-2-28(32(42)37-22-14-15-27(39)24(18-22)33(43)44)45-23-12-7-11-21(17-23)36-31(41)26(16-20-10-6-13-25(34)29(20)35)38-30(40)19-8-4-3-5-9-19/h3-18,28,39H,2H2,1H3,(H,36,41)(H,37,42)(H,38,40)(H,43,44)/b26-16+ |
| InChIKey | UDZRFOWIIGFCIJ-WGOQTCKBSA-N |
| XLogP | 7.32 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|