C32H27ClN4O5S — CID 19312417
5-[2-[3-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-chlorobenzoic acid (PubChem CID 19312417) has the molecular formula C32H27ClN4O5S and a molecular weight of 615.11 g/mol. Its IUPAC name is 5-[2-[3-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[3-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19312417 |
| Molecular Formula | C32H27ClN4O5S |
| Molecular Weight | 615.11 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | 5-[2-[3-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-chlorobenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H27ClN4O5S/c1-2-28(31(40)36-23-13-14-26(33)25(18-23)32(41)42)43-24-12-6-11-22(17-24)35-30(39)27(16-20-8-7-15-34-19-20)37-29(38)21-9-4-3-5-10-21/h3-19,28H,2H2,1H3,(H,35,39)(H,36,40)(H,37,38)(H,41,42)/b27-16- |
| InChIKey | NADALYHJNIPEQI-YUMHPJSZSA-N |
| XLogP | 6.35 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.11 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|