C19H13ClN2O3S — CID 22148264
(E)-2-benzamido-3-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enoic acid (PubChem CID 22148264) has the molecular formula C19H13ClN2O3S and a molecular weight of 384.84 g/mol. Its IUPAC name is (E)-2-benzamido-3-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148264 |
| Molecular Formula | C19H13ClN2O3S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (E)-2-benzamido-3-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ncc(-c2ccccc2Cl)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H13ClN2O3S/c20-14-9-5-4-8-13(14)16-11-21-17(26-16)10-15(19(24)25)22-18(23)12-6-2-1-3-7-12/h1-11H,(H,22,23)(H,24,25)/b15-10+ |
| InChIKey | BMNYOOZWYGWTEB-XNTDXEJSSA-N |
| XLogP | 4.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|