(Z)-2-benzamido-3-chloroprop-2-enoic acid

C10H8ClNO3 — CID 10977157

IUPAC(Z)-2-benzamido-3-chloroprop-2-enoic acid
SMILESO=C(O)/C(=C/Cl)NC(=O)c1ccccc1
InChIInChI=1S/C10H8ClNO3/c11-6-8(10(14)15)12-9(13)7-4-2-1-3-5-7/h1-6H,(H,12,13)(H,14,15)/b8-6-
InChIKeyMNDMXHONALGOSJ-VURMDHGXSA-N
MW225.63 g/mol
LogP1.58
Rot. Bonds3

About (Z)-2-benzamido-3-chloroprop-2-enoic acid

(Z)-2-benzamido-3-chloroprop-2-enoic acid (PubChem CID 10977157) has the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. Its IUPAC name is (Z)-2-benzamido-3-chloroprop-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-benzamido-3-chloroprop-2-enoic acid
PubChem CID10977157
Molecular FormulaC10H8ClNO3
Molecular Weight225.63 g/mol
Exact Mass225.02
IUPAC Name(Z)-2-benzamido-3-chloroprop-2-enoic acid
SMILESO=C(O)/C(=C/Cl)NC(=O)c1ccccc1
InChIInChI=1S/C10H8ClNO3/c11-6-8(10(14)15)12-9(13)7-4-2-1-3-5-7/h1-6H,(H,12,13)(H,14,15)/b8-6-
InChIKeyMNDMXHONALGOSJ-VURMDHGXSA-N
XLogP1.58
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.63
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2-benzamido-3-chloroprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(E)-2-benzamidobut-2-enoic acid
CID 15472529
2-benzamidopenta-2,4-dienoic acid
CID 87146493
(Z)-2-benzamido-4,4,4-trifluorobut-2-enoic acid
CID 141167082
4-[(Z)-2-benzamido-2-carboxyethenyl]phenolate
CID 54712783
2-benzamido-3-(2-fluorophenyl)prop-2-enoic acid
CID 744037
(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoic acid
CID 6209843
2-benzamido-3-(4-fluorophenyl)prop-2-enoic acid
CID 761263
ethane;N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]benzamide
CID 145162824
2-benzamido-3-naphthalen-1-ylprop-2-enoic acid
CID 1099149
(Z)-2-benzamido-3-(4-boronophenyl)prop-2-enoic acid
CID 10913942
(Z)-2-benzamido-4-[hydroxy(methyl)phosphoryl]but-2-enoic acid
CID 68981682
2-benzamido-3-(4-cyanophenyl)prop-2-enoic acid
CID 4769146

Frequently Asked Questions

What is the IUPAC name of (Z)-2-benzamido-3-chloroprop-2-enoic acid?
The IUPAC name of (Z)-2-benzamido-3-chloroprop-2-enoic acid (CID 10977157) is (Z)-2-benzamido-3-chloroprop-2-enoic acid.
What is the SMILES notation for (Z)-2-benzamido-3-chloroprop-2-enoic acid?
The canonical SMILES for (Z)-2-benzamido-3-chloroprop-2-enoic acid is O=C(O)/C(=C/Cl)NC(=O)c1ccccc1.
What is the InChIKey of (Z)-2-benzamido-3-chloroprop-2-enoic acid?
The InChIKey is MNDMXHONALGOSJ-VURMDHGXSA-N. The full InChI is InChI=1S/C10H8ClNO3/c11-6-8(10(14)15)12-9(13)7-4-2-1-3-5-7/h1-6H,(H,12,13)(H,14,15)/b8-6-.
What are the key properties of (Z)-2-benzamido-3-chloroprop-2-enoic acid?
(Z)-2-benzamido-3-chloroprop-2-enoic acid has a molecular weight of 225.63 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-benzamido-3-chloroprop-2-enoic acid is sourced from PubChem (CID 10977157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).