C19H33NO2 — CID 145162824
ethane;N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]benzamide (PubChem CID 145162824) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is ethane;N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]benzamide.
| Compound Name | ethane;N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]benzamide |
|---|---|
| PubChem CID | 145162824 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | ethane;N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]benzamide |
| SMILES | C/C=C(O)\C(=C/C)NC(=O)c1ccccc1.CC.CC.CC |
| InChI | InChI=1S/C13H15NO2.3C2H6/c1-3-11(12(15)4-2)14-13(16)10-8-6-5-7-9-10;3*1-2/h3-9,15H,1-2H3,(H,14,16);3*1-2H3/b11-3+,12-4+;;; |
| InChIKey | RWYBJOMVHVHWSK-FZNPSRLOSA-N |
| XLogP | 5.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|