C15H19NO2 — CID 145169838
N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]-3,4-dimethylbenzamide (PubChem CID 145169838) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 145169838 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]-3,4-dimethylbenzamide |
| SMILES | C/C=C(O)\C(=C/C)NC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H19NO2/c1-5-13(14(17)6-2)16-15(18)12-8-7-10(3)11(4)9-12/h5-9,17H,1-4H3,(H,16,18)/b13-5+,14-6+ |
| InChIKey | UTIJNCXXOABLRU-ACFHMISVSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|