C15H19NO — CID 142217510
ethene;N-[(2E,4Z)-hexa-2,4-dien-3-yl]benzamide (PubChem CID 142217510) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is ethene;N-[(2E,4Z)-hexa-2,4-dien-3-yl]benzamide.
| Compound Name | ethene;N-[(2E,4Z)-hexa-2,4-dien-3-yl]benzamide |
|---|---|
| PubChem CID | 142217510 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | ethene;N-[(2E,4Z)-hexa-2,4-dien-3-yl]benzamide |
| SMILES | C/C=C\C(=C/C)NC(=O)c1ccccc1.C=C |
| InChI | InChI=1S/C13H15NO.C2H4/c1-3-8-12(4-2)14-13(15)11-9-6-5-7-10-11;1-2/h3-10H,1-2H3,(H,14,15);1-2H2/b8-3-,12-4+; |
| InChIKey | DMPHXQRLTUOZSA-SMDNFFBJSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|