C14H14N2OS — CID 130413292
N-[(1E,3E)-1-(methanethioylamino)hexa-1,3,5-trien-3-yl]benzamide (PubChem CID 130413292) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-[(1E,3E)-1-(methanethioylamino)hexa-1,3,5-trien-3-yl]benzamide.
| Compound Name | N-[(1E,3E)-1-(methanethioylamino)hexa-1,3,5-trien-3-yl]benzamide |
|---|---|
| PubChem CID | 130413292 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-[(1E,3E)-1-(methanethioylamino)hexa-1,3,5-trien-3-yl]benzamide |
| SMILES | C=C/C=C(\C=C\NC=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14N2OS/c1-2-6-13(9-10-15-11-18)16-14(17)12-7-4-3-5-8-12/h2-11H,1H2,(H,15,18)(H,16,17)/b10-9+,13-6+ |
| InChIKey | XTPROGJIYPRGFJ-SLJQOXHMSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|