C11H11N3OS — CID 130413370
N-[(3E)-4-(methanethioylamino)buta-1,3-dien-2-yl]pyridine-4-carboxamide (PubChem CID 130413370) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is N-[(3E)-4-(methanethioylamino)buta-1,3-dien-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(3E)-4-(methanethioylamino)buta-1,3-dien-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130413370 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | N-[(3E)-4-(methanethioylamino)buta-1,3-dien-2-yl]pyridine-4-carboxamide |
| SMILES | C=C(/C=C/NC=S)NC(=O)c1ccncc1 |
| InChI | InChI=1S/C11H11N3OS/c1-9(2-5-13-8-16)14-11(15)10-3-6-12-7-4-10/h2-8H,1H2,(H,13,16)(H,14,15)/b5-2+ |
| InChIKey | NHZAVMAVAIMIDW-GORDUTHDSA-N |
| XLogP | 1.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|