C8H6N4OS — CID 169080400
N-(1,2,4-thiadiazol-3-yl)pyridine-4-carboxamide (PubChem CID 169080400) has the molecular formula C8H6N4OS and a molecular weight of 206.23 g/mol. Its IUPAC name is N-(1,2,4-thiadiazol-3-yl)pyridine-4-carboxamide.
| Compound Name | N-(1,2,4-thiadiazol-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169080400 |
| Molecular Formula | C8H6N4OS |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | N-(1,2,4-thiadiazol-3-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ncsn1)c1ccncc1 |
| InChI | InChI=1S/C8H6N4OS/c13-7(6-1-3-9-4-2-6)11-8-10-5-14-12-8/h1-5H,(H,11,12,13) |
| InChIKey | UPTOTVOVSSTKAX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |