C20H21N5O — CID 130411661
N-[(3Z)-5-(3,5-dicyclopropylpyrazol-1-yl)-5-iminopenta-1,3-dien-2-yl]pyridine-4-carboxamide (PubChem CID 130411661) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(3Z)-5-(3,5-dicyclopropylpyrazol-1-yl)-5-iminopenta-1,3-dien-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(3Z)-5-(3,5-dicyclopropylpyrazol-1-yl)-5-iminopenta-1,3-dien-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130411661 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[(3Z)-5-(3,5-dicyclopropylpyrazol-1-yl)-5-iminopenta-1,3-dien-2-yl]pyridine-4-carboxamide |
| SMILES | [H]/N=C(/C=C\C(=C)NC(=O)c1ccncc1)n1nc(C2CC2)cc1C1CC1 |
| InChI | InChI=1S/C20H21N5O/c1-13(23-20(26)16-8-10-22-11-9-16)2-7-19(21)25-18(15-5-6-15)12-17(24-25)14-3-4-14/h2,7-12,14-15,21H,1,3-6H2,(H,23,26)/b7-2-,21-19- |
| InChIKey | PJCGUMDXVKQLBZ-SZUOPTMOSA-N |
| XLogP | 3.36 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|